6949-83-3 Usage
General Description
(Z)-3-[[(4-chlorophenyl)amino]carbamoyl]prop-2-enoic acid, also known as CPAC, is a chemical compound with the molecular formula C11H10ClN3O3. It is an amino acid derivative with a carbamoyl group attached to the amino group of a 4-chlorophenyl ring. (Z)-3-[[(4-chlorophenyl)amino]carbamoyl]prop-2-enoic acid is often used in pharmaceutical research and development, particularly in the study of potential anti-cancer and anti-inflammatory properties. It may also have applications in the development of new drugs for the treatment of various diseases and conditions. Additionally, CPAC has potential industrial uses in the production of new materials and chemicals. Its unique chemical structure and properties make it a valuable compound for various scientific and industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 6949-83-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,9,4 and 9 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 6949-83:
(6*6)+(5*9)+(4*4)+(3*9)+(2*8)+(1*3)=143
143 % 10 = 3
So 6949-83-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H9ClN2O3/c11-7-1-3-8(4-2-7)12-13-9(14)5-6-10(15)16/h1-6,12H,(H,13,14)(H,15,16)/b6-5-
