6950-04-5 Usage
Uses
Used in Coordination Chemistry:
1,2-Di-(4-pyridyl)-1,2-ethanediol is used as a chelating agent for the formation of coordination compounds. Its ability to bind with metal ions makes it a valuable component in the synthesis of metal complexes with potential applications in catalysis, materials science, and medicinal chemistry.
Used in Pharmaceutical Industry:
As a building block for the synthesis of various organic compounds, 1,2-Di-(4-pyridyl)-1,2-ethanediol has been studied for its potential use in pharmaceuticals. Its unique structure allows for the development of new drugs with specific therapeutic properties.
Used in Synthesis of Coordination Polymers:
1,2-Di-(4-pyridyl)-1,2-ethanediol serves as a precursor for the synthesis of coordination polymers. These polymers have potential applications in gas storage, catalysis, and as functional materials in various fields.
Used in Food and Cosmetic Industries:
Due to its demonstrated antioxidant properties, 1,2-Di-(4-pyridyl)-1,2-ethanediol is of interest for potential applications in the food and cosmetic industries. Its ability to neutralize free radicals can contribute to the development of products with enhanced shelf life and improved health benefits.
Check Digit Verification of cas no
The CAS Registry Mumber 6950-04-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,9,5 and 0 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 6950-04:
(6*6)+(5*9)+(4*5)+(3*0)+(2*0)+(1*4)=105
105 % 10 = 5
So 6950-04-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H12N2O2/c15-11(9-1-5-13-6-2-9)12(16)10-3-7-14-8-4-10/h1-8,11-12,15-16H
6950-04-5Relevant academic research and scientific papers
REDUCTIVE REACTIONS OF SUBSTITUTED PYRIDINES BY AQUEOUS TITANIUM TRICHLORIDE
Clerici, Angelo,Porta, Ombretta
, p. 1293 - 1297 (2007/10/02)
Aqueous titanium trichloride reductively removes cyano and halo groups from the correspondingly substituted pyridines by a two electron-transfer process and promotes reduction of pyridyl-ketones and aldehydes to glycols by one electron-transfer process under very simple experimental conditions.