69503-94-2 Usage
Uses
Used in Pharmaceutical Industry:
3,4,6-Tri-O-acetyl-2-deoxy-D-glucopyranose is used as a reactant in the synthesis of Rebeccamycin (R140000) analogs with uncommon sugars. These analogs have demonstrated topoisomerase inhibition and antitumor activities, making them valuable in the development of novel cancer therapeutics. 3,4,6-TRI-O-ACETYL-2-DEOXY-D-GLUCOPYRANOSE's unique structure allows for the creation of new molecules with potential applications in cancer treatment, contributing to the advancement of pharmaceutical research and drug development.
Check Digit Verification of cas no
The CAS Registry Mumber 69503-94-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,9,5,0 and 3 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 69503-94:
(7*6)+(6*9)+(5*5)+(4*0)+(3*3)+(2*9)+(1*4)=152
152 % 10 = 2
So 69503-94-2 is a valid CAS Registry Number.
InChI:InChI=1/C12H18O8/c1-6(13)17-5-10-12(19-8(3)15)9(18-7(2)14)4-11(16)20-10/h9-12,16H,4-5H2,1-3H3/t9-,10-,11u,12+/m1/s1
