69543-98-2 Usage
Uses
Used in Pharmaceutical Industry:
Pyrimidine, 4-bromo-6-methyl(9CI) is used as a building block for the synthesis of pharmaceutical drugs. Its unique structure allows for the development of new and effective medications with potential applications in treating various diseases and conditions.
Used in Agrochemical Industry:
In the agrochemical industry, Pyrimidine, 4-bromo-6-methyl(9CI) serves as a key intermediate in the production of agrochemicals. Its reactivity and structural properties contribute to the creation of effective compounds for pest control and crop protection.
Used in Chemical Research:
Pyrimidine, 4-bromo-6-methyl(9CI) is utilized in chemical research as a valuable intermediate for the synthesis of diverse chemical compounds. Its unique structure and reactivity enable the exploration of new chemical reactions and the development of novel compounds with potential applications in various fields.
Used as a Reference Standard in Analytical Chemistry and Spectroscopic Studies:
Due to its distinct chemical properties, Pyrimidine, 4-bromo-6-methyl(9CI) is employed as a reference standard in analytical chemistry and spectroscopic studies. It helps in the accurate identification, quantification, and characterization of other compounds, ensuring the reliability and accuracy of experimental results.
Check Digit Verification of cas no
The CAS Registry Mumber 69543-98-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,9,5,4 and 3 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 69543-98:
(7*6)+(6*9)+(5*5)+(4*4)+(3*3)+(2*9)+(1*8)=172
172 % 10 = 2
So 69543-98-2 is a valid CAS Registry Number.
InChI:InChI=1/C5H5BrN2/c1-4-2-5(6)8-3-7-4/h2-3H,1H3
