6957-86-4 Usage
Uses
Used in Pharmaceutical Industry:
5-ALLYL-2-AMINO-6-METHYL-PYRIMIDIN-4-OL is used as a therapeutic agent for the treatment of various medical conditions, including cancer and infectious diseases. Its unique chemical structure allows it to target specific biological pathways and mechanisms, making it a promising candidate for the development of new drugs and therapeutic agents.
Used in Cancer Treatment:
In the field of oncology, 5-ALLYL-2-AMINO-6-METHYL-PYRIMIDIN-4-OL is used as an anticancer agent, exhibiting potential activity against a range of cancer types. Its mechanism of action may involve the modulation of cellular processes and signaling pathways, leading to the inhibition of tumor growth and progression.
Used in Infectious Disease Treatment:
5-ALLYL-2-AMINO-6-METHYL-PYRIMIDIN-4-OL is also being studied for its potential use in the treatment of infectious diseases. Its unique chemical properties may allow it to target specific pathogens or modulate the host immune response, offering a new approach to managing and treating various infections.
Used in Agricultural Chemicals:
In the agricultural industry, 5-ALLYL-2-AMINO-6-METHYL-PYRIMIDIN-4-OL has been studied for its potential applications as a pesticide or herbicide. Its chemical properties may enable it to control or eliminate pests and weeds, contributing to more efficient and sustainable agricultural practices.
Overall, 5-ALLYL-2-AMINO-6-METHYL-PYRIMIDIN-4-OL is an important and versatile chemical compound with significant potential in both the medical and agricultural fields. Its unique structure and properties make it a valuable target for research and development, with the potential to contribute to advancements in healthcare and agriculture.
Check Digit Verification of cas no
The CAS Registry Mumber 6957-86-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,9,5 and 7 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 6957-86:
(6*6)+(5*9)+(4*5)+(3*7)+(2*8)+(1*6)=144
144 % 10 = 4
So 6957-86-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H11N3O/c1-3-4-6-5(2)10-8(9)11-7(6)12/h3H,1,4H2,2H3,(H3,9,10,11,12)
6957-86-4Relevant academic research and scientific papers
Fungicidal composition and method containing 2-amino-pyrimidines
-
, (2008/06/13)
Fungicidal pyrimidine derivatives and the use thereof in combatting plant diseases. Representative derivatives are 2-dimethylamino-4-methyl-5-n-pentyl-6-hydroxypyrimidine and 2-dimethylamino-4-methyl-5-n-propyl-6-hydroxypyrimidine.
