69570-83-8 Usage
Uses
Used in Pharmaceutical Industry:
2-(4-BROMOPHENYL)-1,3-THIAZOLANE-4-CARBOXYLIC ACID is used as a building block for the synthesis of various pharmaceuticals and agrochemical products. Its unique structure allows for the creation of new compounds with potential therapeutic effects.
Used in Antimicrobial Applications:
In the field of antimicrobial research, 2-(4-BROMOPHENYL)-1,3-THIAZOLANE-4-CARBOXYLIC ACID is studied for its potential to combat microbial infections. The presence of the bromophenyl group and thiazolane ring may contribute to its effectiveness against certain pathogens.
Used in Anticancer Research:
2-(4-BROMOPHENYL)-1,3-THIAZOLANE-4-CARBOXYLIC ACID is also being investigated for its potential anticancer properties. Its structure may allow it to interact with biological targets in ways that could inhibit cancer cell growth or induce cell death, offering a new avenue for cancer treatment development.
Check Digit Verification of cas no
The CAS Registry Mumber 69570-83-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,9,5,7 and 0 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 69570-83:
(7*6)+(6*9)+(5*5)+(4*7)+(3*0)+(2*8)+(1*3)=168
168 % 10 = 8
So 69570-83-8 is a valid CAS Registry Number.
InChI:InChI=1/C10H10BrNO2S/c11-7-3-1-6(2-4-7)9-12-8(5-15-9)10(13)14/h1-4,8-9,12H,5H2,(H,13,14)/t8-,9+/m0/s1
