69581-17-5 Usage
Uses
Used in Pharmaceutical Industry:
3-CHLORO-5H-INDENO[1,2-C]PYRIDAZINE is used as a chemical intermediate for the development of new pharmaceutical compounds. Its unique structure allows it to be a potential candidate in the synthesis of drugs targeting specific biological pathways or receptors.
Used in Agrochemical Industry:
In the agrochemical sector, 3-CHLORO-5H-INDENO[1,2-C]PYRIDAZINE is used as a building block in the creation of novel agrochemicals. Its chemical properties make it suitable for the development of pesticides, herbicides, or other compounds designed to protect crops and enhance agricultural productivity.
Used in Organic Synthesis:
3-CHLORO-5H-INDENO[1,2-C]PYRIDAZINE is utilized as a key component in organic synthesis processes. Its structure can be modified to produce a variety of complex organic molecules for use in different industries, including the development of new materials, dyes, and other specialty chemicals.
Used in Medicinal Research:
3-CHLORO-5H-INDENO[1,2-C]PYRIDAZINE is employed as a subject of medicinal research to explore its biological activity. Studies may focus on its potential to interact with biological targets, such as enzymes or receptors, which could lead to the discovery of new therapeutic agents or treatments for various diseases.
Used in Chemical and Biological Applications:
Due to its unique structure and properties, 3-CHLORO-5H-INDENO[1,2-C]PYRIDAZINE is used in a wide range of chemical and biological applications. It can serve as a valuable molecule for the development of new chemical processes, the creation of innovative materials, and the advancement of biological research.
Check Digit Verification of cas no
The CAS Registry Mumber 69581-17-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,9,5,8 and 1 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 69581-17:
(7*6)+(6*9)+(5*5)+(4*8)+(3*1)+(2*1)+(1*7)=165
165 % 10 = 5
So 69581-17-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H7ClN2/c12-10-6-8-5-7-3-1-2-4-9(7)11(8)14-13-10/h1-4,6H,5H2
