6960-44-7 Usage
Uses
Used in Pharmaceutical Industry:
5-Amino-1H-indole-3-carboxylic acid is used as a building block for the synthesis of various bioactive molecules and pharmaceutical compounds. Its unique structure and functional groups enable the development of a wide range of therapeutic agents.
Used in Organic Chemistry:
Due to its versatile reactivity, 5-Amino-1H-indole-3-carboxylic acid is utilized in organic chemistry for the synthesis of various organic compounds, contributing to the advancement of chemical research and development.
Used in Medicinal Chemistry:
5-Amino-1H-indole-3-carboxylic acid serves as a precursor for the preparation of indole-based molecules with potential pharmacological activities. It plays a crucial role in the development of anti-cancer and anti-inflammatory drugs, offering new therapeutic options for various medical conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 6960-44-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,9,6 and 0 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 6960-44:
(6*6)+(5*9)+(4*6)+(3*0)+(2*4)+(1*4)=117
117 % 10 = 7
So 6960-44-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H8N2O2/c10-5-1-2-8-6(3-5)7(4-11-8)9(12)13/h1-4,11H,10H2,(H,12,13)
