6963-16-2 Usage
Uses
Used in Fragrance and Flavor Industry:
[Phenyl-(2-phenyl-1,3-dioxolan-2-yl)methyl] acetate is used as a fragrance and flavoring agent due to its distinctive aromatic properties. It contributes to the creation of various scents and tastes in the industry, enhancing the sensory experience of consumer products.
Used in Cosmetics and Personal Care Industry:
In the cosmetics and personal care industry, [phenyl-(2-phenyl-1,3-dioxolan-2-yl)methyl] acetate is used as an ingredient in the production of perfumes, soaps, and other cosmetic products. Its incorporation helps to improve the overall quality and appeal of these products, making them more attractive to consumers.
Used in Pharmaceutical Industry:
[Phenyl-(2-phenyl-1,3-dioxolan-2-yl)methyl] acetate also has potential applications in the pharmaceutical industry. It serves as an intermediate in the synthesis of various pharmaceutical compounds, contributing to the development of new drugs and therapies.
Used in Chemical Synthesis:
This chemical compound is utilized as a valuable intermediate in the synthesis of other chemicals. Its unique structure allows for further chemical reactions and modifications, leading to the creation of new compounds with specific properties and applications across different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 6963-16-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,9,6 and 3 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 6963-16:
(6*6)+(5*9)+(4*6)+(3*3)+(2*1)+(1*6)=122
122 % 10 = 2
So 6963-16-2 is a valid CAS Registry Number.
InChI:InChI=1/C18H18O4/c1-14(19)22-17(15-8-4-2-5-9-15)18(20-12-13-21-18)16-10-6-3-7-11-16/h2-11,17H,12-13H2,1H3
