6971-15-9 Usage
Type of compound
Heterocyclic organic compound
Structural components
Contains both a pyridine and an azonane ring
Common use
As a ligand in coordination chemistry
Ability
To chelate with metal ions to form stable coordination complexes
Potential applications
In medicinal chemistry and drug development
Versatility
Suitable for various scientific and industrial applications
Unique chemical composition
Makes it of interest for further research and development
Check Digit Verification of cas no
The CAS Registry Mumber 6971-15-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,9,7 and 1 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 6971-15:
(6*6)+(5*9)+(4*7)+(3*1)+(2*1)+(1*5)=119
119 % 10 = 9
So 6971-15-9 is a valid CAS Registry Number.
InChI:InChI=1/C15H24N2/c1-2-4-8-13-17(12-7-3-1)14-10-15-9-5-6-11-16-15/h5-6,9,11H,1-4,7-8,10,12-14H2
