6972-36-7 Usage
Uses
Used in Pharmaceutical Industry:
5-Amino-2-chloro-4,6-dimethylnicotinonitrile is used as a key intermediate in the synthesis of various drugs, particularly antifungal agents. Its chemical structure allows for the development of compounds that target and inhibit fungal growth, providing effective treatments for fungal infections.
Used in Agrochemical Industry:
In the agrochemical industry, 5-Amino-2-chloro-4,6-dimethylnicotinonitrile is utilized as a precursor for the production of pesticides. Its reactivity and structural features enable the creation of compounds that can effectively control and eliminate pests, thereby protecting crops and ensuring agricultural productivity.
Used in Organic Synthesis:
Due to its chemical reactivity and versatility, 5-Amino-2-chloro-4,6-dimethylnicotinonitrile is employed in various organic synthesis processes. It can be used to create a wide range of chemical compounds for different applications, including the development of new pharmaceuticals, agrochemicals, and other specialty chemicals.
It is crucial to handle 5-Amino-2-chloro-4,6-dimethylnicotinonitrile with care and adhere to safety guidelines to minimize potential hazards to human health and the environment. Proper handling, storage, and disposal practices are essential to ensure the safe use of 5-AMino-2-chloro-4,6-diMethylnicotinonitrile in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 6972-36-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,9,7 and 2 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 6972-36:
(6*6)+(5*9)+(4*7)+(3*2)+(2*3)+(1*6)=127
127 % 10 = 7
So 6972-36-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H8ClN3/c1-4-6(3-10)8(9)12-5(2)7(4)11/h11H2,1-2H3
