6972-56-1 Usage
Uses
Used in Pharmaceutical Applications:
1H-Naphth[1,2-d]imidazol-7-ol(9CI) is utilized as a pharmaceutical intermediate for the development of new drugs. Its unique structure allows it to be a potential candidate in the synthesis of various medicinal compounds, contributing to the advancement of novel therapeutic agents.
Used in Organic Synthesis:
In the realm of organic synthesis, 1H-Naphth[1,2-d]imidazol-7-ol(9CI) serves as a key building block for the creation of complex organic molecules. Its presence in the synthesis process can lead to the formation of a wide range of chemical entities, expanding the scope of chemical research and innovation.
Used in Drug Development:
Due to its potential biological activities, 1H-Naphth[1,2-d]imidazol-7-ol(9CI) is considered for direct use in drug development. Its capacity to interact with biological targets makes it a valuable asset in the discovery and design of new pharmaceuticals aimed at treating various diseases and conditions.
Used in Chemical Research:
1H-Naphth[1,2-d]imidazol-7-ol(9CI) is also employed in chemical research to study its properties and reactivity. Understanding its behavior in different chemical environments can provide insights into the development of new synthetic methods and the creation of novel chemical entities.
Check Digit Verification of cas no
The CAS Registry Mumber 6972-56-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,9,7 and 2 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 6972-56:
(6*6)+(5*9)+(4*7)+(3*2)+(2*5)+(1*6)=131
131 % 10 = 1
So 6972-56-1 is a valid CAS Registry Number.
InChI:InChI=1/C11H8N2O/c14-8-2-3-9-7(5-8)1-4-10-11(9)13-6-12-10/h1-6,14H,(H,12,13)
