6972-86-7 Usage
Uses
Used in Pharmaceutical Industry:
6-Hydroxyquinoline-3-carboxylic acid ethyl ester is used as an intermediate in the synthesis of pharmaceuticals for its potential applications in the production of antimalarial and antibacterial drugs. Its unique chemical structure allows for the development of new drug candidates with improved efficacy and reduced side effects.
Used in Agrochemical Industry:
In the agrochemical industry, 6-Hydroxyquinoline-3-carboxylic acid ethyl ester is used as an intermediate in the synthesis of agrochemicals, contributing to the development of novel pesticides and other agricultural chemicals. Its versatility in chemical reactions enables the creation of new compounds with enhanced pest control properties and reduced environmental impact.
Used in Chemical Research and Development:
6-Hydroxyquinoline-3-carboxylic acid ethyl ester is used as a building block in the synthesis of heterocyclic compounds and coordination complexes for various chemical applications. Its ability to form stable complexes with metal ions makes it a valuable component in the development of new materials with unique properties, such as catalysts, sensors, and functional materials.
Used in Biological Research and Development:
In the field of biological research and development, 6-Hydroxyquinoline-3-carboxylic acid ethyl ester is utilized in the synthesis of coordination complexes with potential applications in bioimaging, drug delivery, and targeted therapies. Its ability to chelate metal ions and form stable complexes allows for the development of new contrast agents and therapeutic agents with improved targeting and bioavailability.
Check Digit Verification of cas no
The CAS Registry Mumber 6972-86-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,9,7 and 2 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 6972-86:
(6*6)+(5*9)+(4*7)+(3*2)+(2*8)+(1*6)=137
137 % 10 = 7
So 6972-86-7 is a valid CAS Registry Number.
InChI:InChI=1/C12H11NO3/c1-2-16-12(15)9-5-8-6-10(14)3-4-11(8)13-7-9/h3-7,14H,2H2,1H3
