6973-52-0 Usage
Uses
Used in Pharmaceutical Industry:
4-Pyrimidinecarboxylic acid, 2-amino-1,6-dihydro-6-oxo(9CI) is used as a key intermediate in the synthesis of various pharmaceuticals for its ability to contribute to the development of bioactive molecules. Its structural features allow for the creation of compounds with potential therapeutic effects.
Used in Agrochemical Industry:
In the agrochemical sector, 4-Pyrimidinecarboxylic acid, 2-amino-1,6-dihydro-6-oxo(9CI) serves as a building block for the synthesis of agrochemicals, contributing to the development of effective products for agricultural applications.
Used in Dye and Pigment Production:
4-Pyrimidinecarboxylic acid, 2-amino-1,6-dihydro-6-oxo(9CI) is utilized in the production of dyes and pigments due to its chemical properties that allow for the creation of a wide range of colors and shades.
Used in Material Science and Chemical Industries:
4-Pyrimidinecarboxylic acid, 2-amino-1,6-dihydro-6-oxo(9CI) plays a role in the advancement of new material science and chemical industries, where its unique structural and reactive properties are harnessed for the development of innovative materials and chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 6973-52-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,9,7 and 3 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 6973-52:
(6*6)+(5*9)+(4*7)+(3*3)+(2*5)+(1*2)=130
130 % 10 = 0
So 6973-52-0 is a valid CAS Registry Number.
InChI:InChI=1/C5H5N3O3/c6-5-7-2(4(10)11)1-3(9)8-5/h1H,(H,10,11)(H3,6,7,8,9)
