6973-52-0 Usage
General Description
4-Pyrimidinecarboxylic acid, 2-amino-1,6-dihydro-6-oxo- (9CI) is a chemical compound with the molecular formula C6H6N2O3. It is a pyrimidine derivative that contains an amino group and a carboxylic acid group. 4-Pyrimidinecarboxylic acid, 2-amino-1,6-dihydro-6-oxo- (9CI) is often used as a building block in the synthesis of various pharmaceuticals and agrochemicals. It can also be utilized in the production of dyes and pigments. The compound has potential applications in medicinal chemistry due to its structural characteristics and reactivity, making it a valuable intermediate in the synthesis of various bioactive molecules. Additionally, 4-Pyrimidinecarboxylic acid, 2-amino-1,6-dihydro-6-oxo- (9CI) plays a role in the development of new material science and chemical industries.
Check Digit Verification of cas no
The CAS Registry Mumber 6973-52-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,9,7 and 3 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 6973-52:
(6*6)+(5*9)+(4*7)+(3*3)+(2*5)+(1*2)=130
130 % 10 = 0
So 6973-52-0 is a valid CAS Registry Number.
InChI:InChI=1/C5H5N3O3/c6-5-7-2(4(10)11)1-3(9)8-5/h1H,(H,10,11)(H3,6,7,8,9)
