6973-81-5 Usage
Uses
Used in Pharmaceutical Research:
4(1H)-Pyrimidinone, 2-amino-6-mercapto(9CI) is used as a building block in the synthesis of complex molecules for pharmaceutical research. Its unique structure, which includes the pyrimidinone ring, amino, and mercapto functional groups, allows it to be integrated into various compounds that may have potential therapeutic applications.
Used in Chemical Research:
In the field of chemical research, 4(1H)-Pyrimidinone, 2-amino-6-mercapto(9CI) is used as a reagent or intermediate in the development of new chemical compounds. Its potential reactivity and structural features make it a valuable component in the synthesis of novel molecules with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 6973-81-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,9,7 and 3 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 6973-81:
(6*6)+(5*9)+(4*7)+(3*3)+(2*8)+(1*1)=135
135 % 10 = 5
So 6973-81-5 is a valid CAS Registry Number.
InChI:InChI=1/C4H5N3OS/c5-4-6-2(8)1-3(9)7-4/h1H,(H4,5,6,7,8,9)
6973-81-5Relevant academic research and scientific papers
Structural studies of pterin-based inhibitors of dihydropteroate synthase
Hevener, Kirk E.,Yun, Mi-Kyung,Qi, Jianjun,Kerr, Iain D.,Babaoglu, Kerim,Hurdle, Julian G.,Balakrishna, Kanya,White, Stephen W.,Lee, Richard E.
supporting information; experimental part, p. 166 - 177 (2010/04/29)
Dihydropteroate synthase (DHPS) is a key enzyme in bacterial folate synthesis and the target of the sulfonamide class of antibacterials. Resistance and toxicities associated with sulfonamides have led to a decrease in their clinical use. Compounds that bi
