69736-33-0 Usage
Uses
Used in Organic Synthesis:
3-Benzyloxypheylglyoxal hydrate is used as a building block in the synthesis of complex organic molecules for its ability to participate in various chemical reactions, making it a valuable component in creating intricate molecular structures.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 3-Benzyloxypheylglyoxal hydrate is used as a precursor in the development of biologically active compounds, contributing to the creation of new drugs and therapeutic agents.
Used in Chemical Industry:
3-Benzyloxypheylglyoxal hydrate is employed in the chemical industry for its versatility in chemical reactions, allowing for the production of a wide range of chemical products.
Used in Organic Chemistry Research:
As a reagent in organic chemistry research, 3-Benzyloxypheylglyoxal hydrate is utilized to study and understand various chemical reactions and mechanisms, furthering scientific knowledge in the field.
Check Digit Verification of cas no
The CAS Registry Mumber 69736-33-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,9,7,3 and 6 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 69736-33:
(7*6)+(6*9)+(5*7)+(4*3)+(3*6)+(2*3)+(1*3)=170
170 % 10 = 0
So 69736-33-0 is a valid CAS Registry Number.
InChI:InChI=1/C15H12O3.H2O/c16-10-15(17)13-7-4-8-14(9-13)18-11-12-5-2-1-3-6-12;/h1-10H,11H2;1H2
