69741-89-5 Usage
Uses
Used in Pharmaceutical Industry:
5-PROPYL-1,3,4-OXADIAZOL-2-YLAMINE is used as a key intermediate in the synthesis of new pharmaceuticals due to its unique properties and structure. It plays a crucial role in the development of innovative drugs and therapeutic agents.
Used in Organic Synthesis:
As an intermediate in organic synthesis, 5-PROPYL-1,3,4-OXADIAZOL-2-YLAMINE is utilized for the creation of complex organic molecules, contributing to advancements in the field of chemistry.
Used in Materials Science:
5-PROPYL-1,3,4-OXADIAZOL-2-YLAMINE may have potential applications in materials science, where its unique structure could be employed to develop new materials with specific properties.
Used in Agrochemicals:
5-PROPYL-1,3,4-OXADIAZOL-2-YLAMINE may also find use in the agrochemical industry, where it could be incorporated into the development of new pesticides or other agricultural chemicals to improve crop protection and yield.
Check Digit Verification of cas no
The CAS Registry Mumber 69741-89-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,9,7,4 and 1 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 69741-89:
(7*6)+(6*9)+(5*7)+(4*4)+(3*1)+(2*8)+(1*9)=175
175 % 10 = 5
So 69741-89-5 is a valid CAS Registry Number.
InChI:InChI=1/C5H9N3O/c1-2-3-4-7-8-5(6)9-4/h2-3H2,1H3,(H2,6,8)
