697737-74-9 Usage
General Description
9H-Fluorene-9-methanol,9-(methoxymethyl)- is a chemical compound that belongs to the family of fluorene derivatives. It is a white solid with a molecular formula of C21H22O2 and a molecular weight of 306.4 g/mol. 9H-Fluorene-9-methanol,9-(methoxymethyl)- is commonly used in organic synthesis and has potential applications in the pharmaceutical and agrochemical industries. Its methoxymethyl group makes it a versatile building block for the synthesis of various complex organic molecules. Additionally, its fluorene backbone provides it with unique electronic and structural properties, making it a valuable molecule for research and development in the field of organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 697737-74-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,9,7,7,3 and 7 respectively; the second part has 2 digits, 7 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 697737-74:
(8*6)+(7*9)+(6*7)+(5*7)+(4*3)+(3*7)+(2*7)+(1*4)=239
239 % 10 = 9
So 697737-74-9 is a valid CAS Registry Number.
InChI:InChI=1/C16H16O2/c1-18-11-16(10-17)14-8-4-2-6-12(14)13-7-3-5-9-15(13)16/h2-9,17H,10-11H2,1H3
