698-28-2 Usage
General Description
5-Pyrimidinemethanol, 2,4-dimethyl- (7CI,8CI,9CI) is a chemical compound with the molecular formula C7H10N2O. It is a derivative of pyrimidine, a heterocyclic organic compound. This chemical is classified as a methanol derivative due to the presence of the hydroxyl group, which is typical of alcohols. The 2,4-dimethyl substitution on the pyrimidine ring contributes to the compound's unique properties and potential applications. This chemical may have uses in various industries, including pharmaceuticals, agriculture, and chemical manufacturing. Its precise applications and properties would depend on further research and testing.
Check Digit Verification of cas no
The CAS Registry Mumber 698-28-2 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 6,9 and 8 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 698-28:
(5*6)+(4*9)+(3*8)+(2*2)+(1*8)=102
102 % 10 = 2
So 698-28-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H10N2O/c1-5-7(4-10)3-8-6(2)9-5/h3,10H,4H2,1-2H3