6986-90-9 Usage
Description
2-(1H-IMIDAZOL-4-YL)-1-METHYL-ETHYLAMINE 2HCL is an aralkylamino compound that is histamine bearing a methyl substituent at the alpha-position. It is a chemical compound with a unique structure that has potential applications in various fields due to its specific properties.
Uses
Used in Pharmaceutical Industry:
2-(1H-IMIDAZOL-4-YL)-1-METHYL-ETHYLAMINE 2HCL is used as a pharmaceutical compound for its potential therapeutic effects. 2-(1H-IMIDAZOL-4-YL)-1-METHYL-ETHYLAMINE 2HCL's unique structure allows it to interact with specific biological targets, making it a promising candidate for the development of new drugs.
Used in Chemical Research:
2-(1H-IMIDAZOL-4-YL)-1-METHYL-ETHYLAMINE 2HCL is used as a research chemical for studying its properties and potential applications in various fields. Its unique structure and functional groups make it an interesting subject for chemical and biological research.
Used in Material Science:
2-(1H-IMIDAZOL-4-YL)-1-METHYL-ETHYLAMINE 2HCL can be used as a component in the development of new materials with specific properties. Its unique structure and functional groups may contribute to the creation of materials with enhanced characteristics for various applications.
Used in Analytical Chemistry:
2-(1H-IMIDAZOL-4-YL)-1-METHYL-ETHYLAMINE 2HCL can be used as a reference compound or a standard in analytical chemistry for the development and validation of new analytical methods or the identification and quantification of similar compounds in complex samples.
Check Digit Verification of cas no
The CAS Registry Mumber 6986-90-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,9,8 and 6 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 6986-90:
(6*6)+(5*9)+(4*8)+(3*6)+(2*9)+(1*0)=149
149 % 10 = 9
So 6986-90-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H11N3/c1-5(7)2-6-3-8-4-9-6/h3-5H,2,7H2,1H3,(H,8,9)
