69882-11-7 Usage
General Description
Poly(2,6-dibromophenol oxide) is a polymer compound that is derived from 2,6-dibromophenol, a chemical compound used in the production of flame retardants and biocides. The polymer's molecular structure consists of repeating units of 2,6-dibromophenol oxide, which gives it flame retardant properties and makes it useful in the production of materials that require fire resistance such as textiles, coatings, and insulating materials. Additionally, its bromine atoms contribute to its biocidal properties, making it effective in preventing the growth of microorganisms, making it useful in applications such as water treatment and pharmaceuticals. Its unique combination of flame retardant and biocidal properties makes Poly(2,6-dibromophenol oxide) a versatile and valuable chemical in various industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 69882-11-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,9,8,8 and 2 respectively; the second part has 2 digits, 1 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 69882-11:
(7*6)+(6*9)+(5*8)+(4*8)+(3*2)+(2*1)+(1*1)=177
177 % 10 = 7
So 69882-11-7 is a valid CAS Registry Number.
InChI:InChI=1/2C6H4Br2O/c7-4-1-2-6(9)5(8)3-4;7-4-2-1-3-5(8)6(4)9/h2*1-3,9H
