699-97-8 Usage
General Description
5-Norbornene-2-endo,3-endo-dimethanol is a chemical compound, also known as endo,endo-2,3-dimethylnorbornane or 2,3-endo-endo-norbornanediol. It belongs to the class of organic compounds known as secondary alcohols, which are compounds containing a secondary alcohol functional group where the carbon atom of the hydroxyl group is linked to two other carbon atoms. This chemical is typically a white to off-white solid and its common uses are not widely documented. It's crucial to handle this chemical with proper safety measures as with any chemical substances. Its exact properties such as toxicity or potential hazards are not thoroughly researched, highlighting the importance of careful usage.
Check Digit Verification of cas no
The CAS Registry Mumber 699-97-8 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 6,9 and 9 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 699-97:
(5*6)+(4*9)+(3*9)+(2*9)+(1*7)=118
118 % 10 = 8
So 699-97-8 is a valid CAS Registry Number.
InChI:InChI=1/C9H14O2/c10-4-8-6-1-2-7(3-6)9(8)5-11/h1-2,6-11H,3-5H2/t6-,7+,8-,9+
