69945-13-7 Usage
General Description
4,4'-BIS(2-AMINO-6-METHYLPYRIMIDYL) DISULFIDE is a chemical compound that consists of two 2-amino-6-methylpyrimidine molecules linked together by a disulfide bond. It is commonly used as a crosslinking agent in the rubber and polymer industries, where it helps to improve the physical and chemical properties of materials. 4,4'-BIS(2-AMINO-6-METHYLPYRIMIDYL) DISULFIDE has also been studied for its potential as an anti-cancer agent due to its ability to induce cell death in cancer cells. Additionally, it has been investigated for its antimicrobial properties and may have potential use in the development of new antibacterial and antifungal agents. Overall, 4,4'-BIS(2-AMINO-6-METHYLPYRIMIDYL) DISULFIDE has a range of industrial and potential biomedical applications.
Check Digit Verification of cas no
The CAS Registry Mumber 69945-13-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,9,9,4 and 5 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 69945-13:
(7*6)+(6*9)+(5*9)+(4*4)+(3*5)+(2*1)+(1*3)=177
177 % 10 = 7
So 69945-13-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H12N6S2/c1-5-3-7(15-9(11)13-5)17-18-8-4-6(2)14-10(12)16-8/h3-4H,1-2H3,(H2,11,13,15)(H2,12,14,16)
