69945-57-9 Usage
Uses
Used in Pharmaceutical Industry:
2,4-Diamino-5-(3-fluorobenzyl)pyrimidine is used as an intermediate in the synthesis of pharmaceuticals for its ability to contribute to the development of new drugs. Its unique structure allows for the creation of compounds with specific biological activities, making it a promising candidate for medicinal chemistry.
Used in Agrochemical Industry:
In the agrochemical sector, 2,4-Diamino-5-(3-fluorobenzyl)pyrimidine is utilized as an intermediate in the synthesis of agrochemicals, contributing to the development of effective and targeted pest control agents. Its chemical properties enable the design of compounds with specific modes of action, enhancing crop protection strategies.
Used in Organic Synthesis:
2,4-Diamino-5-(3-fluorobenzyl)pyrimidine serves as a building block in organic synthesis, allowing chemists to construct a wide range of chemical compounds with diverse applications. Its versatile structure facilitates the synthesis of complex molecules, making it an invaluable component in the creation of novel chemical entities with potential uses in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 69945-57-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,9,9,4 and 5 respectively; the second part has 2 digits, 5 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 69945-57:
(7*6)+(6*9)+(5*9)+(4*4)+(3*5)+(2*5)+(1*7)=189
189 % 10 = 9
So 69945-57-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H11FN4/c12-9-3-1-2-7(5-9)4-8-6-15-11(14)16-10(8)13/h1-3,5-6H,4H2,(H4,13,14,15,16)
