70-97-3 Usage
General Description
1-(p-Phenoxyphenyl)glyoxal is a chemical compound with the molecular formula C14H11NO3. It is a glyoxal derivative with a phenoxyphenyl group attached to the glyoxal moiety. 1-(p-Phenoxyphenyl)glyoxal is used in the field of organic chemistry as a reagent for the synthesis of various organic compounds. It is also known for its potential applications in the development of pharmaceuticals and agrochemicals. Additionally, its unique chemical structure provides opportunities for further research and exploration of its properties and potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 70-97-3 includes 5 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 2 digits, 7 and 0 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 70-97:
(4*7)+(3*0)+(2*9)+(1*7)=53
53 % 10 = 3
So 70-97-3 is a valid CAS Registry Number.
InChI:InChI=1/C14H10O3/c15-10-14(16)11-6-8-13(9-7-11)17-12-4-2-1-3-5-12/h1-10H
