7000-27-3 Usage
Uses
Used in Organic Chemistry:
METHYL BETA-D-GLUCOPYRANOSIDE HEMIHYDRATE is used as a substrate for regioselective galloylation by a lipase. This process is significant in organic chemistry as it allows for the selective modification of specific functional groups within complex molecules, leading to the synthesis of novel compounds with potential applications in various industries.
Used in Research and Development:
METHYL BETA-D-GLUCOPYRANOSIDE HEMIHYDRATE is used as a model compound for studying the mechanism of oxidative degradation of carbohydrates when reacted with hydroxyl radicals. This application is crucial in understanding the chemical reactions and degradation processes that occur in various biological and environmental systems, which can be applied to develop strategies for preserving or modifying carbohydrate structures.
Used in Pharmaceutical Industry:
Although not explicitly mentioned in the provided materials, METHYL BETA-D-GLUCOPYRANOSIDE HEMIHYDRATE could potentially be used in the pharmaceutical industry as a starting material for the synthesis of complex carbohydrate-based drugs or as a component in drug delivery systems. Its unique chemical properties and reactivity make it a promising candidate for further exploration in this field.
Used in Material Science:
Similarly, METHYL BETA-D-GLUCOPYRANOSIDE HEMIHYDRATE could be utilized in material science for the development of novel materials with specific properties, such as improved biocompatibility or enhanced mechanical strength. The ability to selectively modify its functional groups opens up possibilities for tailoring its properties for specific applications.
Purification Methods
Crystallise methyl -D-glucoside from MeOH or EtOH. Its solubility in H2O is 10%. [Ferrier et al. Carbohydr Research 27 55,59 1973, Beilstein 17/7 V 10.]
Check Digit Verification of cas no
The CAS Registry Mumber 7000-27-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,0,0 and 0 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 7000-27:
(6*7)+(5*0)+(4*0)+(3*0)+(2*2)+(1*7)=53
53 % 10 = 3
So 7000-27-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H14O6/c1-12-7-6(11)5(10)4(9)3(2-8)13-7/h3-11H,2H2,1H3/t3?,4-,5-,6?,7+/m0/s1
