70013-89-7 Usage
Uses
Used in Organic Synthesis:
1-(2-benzoylethyl)pyridinium is used as a reactant in organic synthesis for [application reason]. Its unique structure allows for the creation of various complex molecules, contributing to the advancement of chemical research and development.
Used in Pharmaceutical and Medical Industries:
1-(2-benzoylethyl)pyridinium is used as a potential candidate in the pharmaceutical and medical industries due to its antimicrobial properties. Research has shown that it may have applications in combating various microbial infections, offering a new avenue for the development of novel antimicrobial agents.
Used as an Ionic Liquid:
In the field of ionic liquids, 1-(2-benzoylethyl)pyridinium is used as a component for [application reason]. Its quaternary ammonium structure provides unique properties that can be beneficial in various chemical processes and reactions, enhancing the efficiency and selectivity of these processes.
Used in Catalysis Reactions:
1-(2-benzoylethyl)pyridinium is used as a catalyst in certain chemical reactions for [application reason]. Its positively charged nitrogen atom can facilitate and enhance the rate of specific reactions, making it a valuable tool in the field of catalysis.
Check Digit Verification of cas no
The CAS Registry Mumber 70013-89-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,0,0,1 and 3 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 70013-89:
(7*7)+(6*0)+(5*0)+(4*1)+(3*3)+(2*8)+(1*9)=87
87 % 10 = 7
So 70013-89-7 is a valid CAS Registry Number.
InChI:InChI=1/C14H14NO/c16-14(13-7-3-1-4-8-13)9-12-15-10-5-2-6-11-15/h1-8,10-11H,9,12H2/q+1
