701298-97-7 Usage
Uses
Used in Pharmaceutical Industry:
3-Bromo-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepine is used as a key intermediate in the synthesis of various pharmaceuticals for its unique structural properties and potential to contribute to the development of new therapeutic agents.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, 3-Bromo-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepine serves as a valuable compound for further research and development. Its unique structure allows for exploration in the synthesis of novel drug candidates and the enhancement of existing pharmaceuticals.
Used in Drug Development:
3-Bromo-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepine is utilized in drug development as a building block for creating new molecules with potential therapeutic effects. Its presence in the molecular structure can influence the pharmacological properties, such as potency, selectivity, and pharmacokinetics of the resulting compounds.
Used in Chemical Synthesis:
3-Bromo-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepine is also used in chemical synthesis to explore its reactivity and potential to form new chemical entities. The presence of the bromine atom and the nitrogen-containing heterocyclic ring provide opportunities for various synthetic pathways and the creation of diverse chemical libraries.
Used in Biological Evaluation:
3-Bromo-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepine is employed in biological evaluation to assess its potential as a therapeutic agent or its ability to modulate biological targets. This evaluation helps in understanding the compound's pharmacological profile and its suitability for further development as a drug candidate.
Check Digit Verification of cas no
The CAS Registry Mumber 701298-97-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,0,1,2,9 and 8 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 701298-97:
(8*7)+(7*0)+(6*1)+(5*2)+(4*9)+(3*8)+(2*9)+(1*7)=157
157 % 10 = 7
So 701298-97-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H11BrN2/c9-7-6-10-8-4-2-1-3-5-11(7)8/h6H,1-5H2
701298-97-7Relevant academic research and scientific papers
IMIDAZOLE DERIVATIVE, PROCESS FOR PRODUCING THE SAME, AND USE
-
Page/Page column 66-67, (2010/02/13)
There is provided an imidazole derivative useful as a thrombosis treating agent, which is represented by the formula (I): wherein R represents an optionally substituted cyclic hydrocarbon group or an optionally substituted heterocyclic group, W represents
