702-27-2 Usage
Uses
Used in Organic Synthesis:
(1S,2S)-2-phenoxycyclopropan-1-amine is used as a key intermediate in organic synthesis for the creation of various complex organic molecules. Its unique structure allows for specific reactions that can lead to the formation of a wide range of compounds.
Used in Drug Development:
(1S,2S)-2-phenoxycyclopropan-1-amine is utilized as a building block in the development of new pharmaceuticals. Its reactivity and the presence of a chiral center make it a promising candidate for the synthesis of enantiomerically pure drugs, which can have improved therapeutic effects and reduced side effects.
Used in the Production of Pharmaceuticals:
Due to its unique structure and reactivity, (1S,2S)-2-phenoxycyclopropan-1-amine has the potential to be used in the production of pharmaceuticals. Its incorporation into drug molecules could lead to the development of new medications with novel mechanisms of action.
Used in the Production of Agrochemicals:
(1S,2S)-2-phenoxycyclopropan-1-amine may also find use in the agrochemical industry. Its properties could be harnessed to create new pesticides, herbicides, or other agricultural chemicals that are more effective, environmentally friendly, or have fewer negative impacts on non-target organisms.
Overall, (1S,2S)-2-phenoxycyclopropan-1-amine is a versatile compound with a broad range of potential applications across different industries, making it a valuable subject for further research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 702-27-2 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 7,0 and 2 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 702-27:
(5*7)+(4*0)+(3*2)+(2*2)+(1*7)=52
52 % 10 = 2
So 702-27-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H11NO/c10-8-6-9(8)11-7-4-2-1-3-5-7/h1-5,8-9H,6,10H2/t8-,9-/m0/s1