70225-05-7 Usage
Uses
Used in Chemical Industry:
TRIDECYLTRIMELLITATE is used as a chemical intermediate for the synthesis of optical polyamideimides. Its unique molecular structure allows it to contribute to the formation of high-performance polymers with desirable properties such as thermal stability, mechanical strength, and optical clarity.
Used in Plastics and Polymer Industry:
TRIDECYLTRIMELLITATE is used as a plasticizer and a component in the production of various types of plastics and polymers. Its incorporation into these materials enhances their flexibility, durability, and overall performance, making them suitable for a wide range of applications, including automotive, electronics, and packaging industries.
Used in Coatings Industry:
TRIDECYLTRIMELLITATE is used as a component in the formulation of coatings, inks, and adhesives. Its presence in these formulations improves their adhesion, flexibility, and resistance to environmental factors such as UV radiation, moisture, and temperature fluctuations.
Used in Lubricants Industry:
TRIDECYLTRIMELLITATE is used as a lubricant additive in various industrial applications. Its incorporation into lubricants enhances their performance by reducing friction, wear, and heat generation, leading to improved efficiency and longer service life of machinery and equipment.
Check Digit Verification of cas no
The CAS Registry Mumber 70225-05-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,0,2,2 and 5 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 70225-05:
(7*7)+(6*0)+(5*2)+(4*2)+(3*5)+(2*0)+(1*5)=87
87 % 10 = 7
So 70225-05-7 is a valid CAS Registry Number.
InChI:InChI=1/C42H72O6/c1-6-7-8-9-10-11-12-13-14-19-24-31-46-40(43)37-29-30-38(41(44)47-32-25-20-15-17-22-27-35(2)3)39(34-37)42(45)48-33-26-21-16-18-23-28-36(4)5/h29-30,34-36H,6-28,31-33H2,1-5H3