70236-46-3 Usage
Compound type
2-[[4-(dimethylamino)phenyl]azo]-1,3-dimethyl-1H-imidazolium trichlorozincate(1-) is a complex compound consisting of an organic cation and an inorganic anion.
Cation
The 1,3-dimethyl-1H-imidazolium cation contains a dimethylamino group and an azo group attached to a phenyl ring.
Dimethylamino group
A functional group consisting of a nitrogen atom bonded to two methyl groups, which contributes to the basicity and solubility of the compound.
Azo group
A group with the structure -N=Nthat connects two aromatic rings, responsible for the compound's color and redox properties.
Anion
The trichlorozincate anion contains three chloride ions coordinated to a central zinc atom.
Zinc atom
A divalent metal ion that acts as the central atom in the anion, coordinating with the chloride ions and providing a stable structure.
Application
2-[[4-(dimethylamino)phenyl]azo]-1,3-dimethyl-1H-imidazolium trichlorozincate(1-) is used in coordination chemistry and as a precursor for the synthesis of other complex compounds.
Unique structure and properties
The compound's structure and properties make it a valuable building block in the field of chemical research and application, particularly in the synthesis of new materials and catalysts.
Check Digit Verification of cas no
The CAS Registry Mumber 70236-46-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,0,2,3 and 6 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 70236-46:
(7*7)+(6*0)+(5*2)+(4*3)+(3*6)+(2*4)+(1*6)=103
103 % 10 = 3
So 70236-46-3 is a valid CAS Registry Number.
InChI:InChI=1/C13H18N5.3ClH.Zn/c1-16(2)12-7-5-11(6-8-12)14-15-13-17(3)9-10-18(13)4;;;;/h5-10H,1-4H3;3*1H;/q+1;;;;+2/p-3
