70275-54-6 Usage
General Description
[2-(4-HYDROXY-PHENYL)-ETHYL]-CARBAMIC ACID ETHYL ESTER is a chemical compound with the molecular formula C11H13NO4. It is an ethyl ester of [2-(4-hydroxy-phenyl)-ethyl]-carbamic acid, and it is commonly used in the pharmaceutical industry as an intermediate in the production of various drugs. Its structure contains a carbamate group, which has been implicated in the inhibition of various enzymes and receptors. [2-(4-HYDROXY-PHENYL)-ETHYL]-CARBAMIC ACID ETHYL ESTER is also known for its potential use in the treatment of various diseases, including cancer, due to its ability to modulate cellular pathways. Additionally, [2-(4-HYDROXY-PHENYL)-ETHYL]-CARBAMIC ACID ETHYL ESTER may have other potential applications in the field of organic chemistry and biochemistry, making it a valuable and versatile chemical compound.
Check Digit Verification of cas no
The CAS Registry Mumber 70275-54-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,0,2,7 and 5 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 70275-54:
(7*7)+(6*0)+(5*2)+(4*7)+(3*5)+(2*5)+(1*4)=116
116 % 10 = 6
So 70275-54-6 is a valid CAS Registry Number.
InChI:InChI=1/C11H15NO3/c1-2-15-11(14)12-8-7-9-3-5-10(13)6-4-9/h3-6,13H,2,7-8H2,1H3,(H,12,14)
70275-54-6Relevant articles and documents
OPIOID RECEPTOR ANTAGONISTS
-
Page/Page column 16; 31, (2010/02/14)
A compound of the formula (I) wherein the variables X1, X2, B, D, R1 to R7.including R3', p, y, q, and z, are as defined or a pharmaceutically acceptable salt, solvate, enantiomer, racemate, diastereomer or mixtures thereof, useful for the treatment, prev
