70283-04-4 Usage
Description
(Z)-N-pyren-1-yl-9-octadecenamide is a chemical compound derived from pyrene, a polycyclic aromatic hydrocarbon, featuring a pyren-1-yl group attached to a 9-octadecenamide moiety. (Z)-N-pyren-1-yl-9-octadecenamide is characterized by its long hydrocarbon chain and unique properties, making it a versatile and potentially valuable compound for various scientific applications.
Uses
Used in Organic Chemistry and Materials Science:
(Z)-N-pyren-1-yl-9-octadecenamide is used as a building block for the development of new materials, such as polymers and coatings, due to its aromatic nature and potential for self-assembly. Its unique structure allows for the creation of materials with specific properties tailored for various applications.
Used in Biological Science:
In the field of biological science, (Z)-N-pyren-1-yl-9-octadecenamide may be used as a tool for studying lipid membranes and their interactions with other molecules. Its structure and properties could provide insights into the behavior of biological membranes and contribute to the understanding of cellular processes.
Used in Pharmaceutical Research:
Although not explicitly mentioned in the provided materials, the compound's potential applications in the pharmaceutical industry could be explored, given its unique structure and properties. It may have potential uses in drug design or as a component in the development of novel therapeutic agents.
Used in Chemical Synthesis:
(Z)-N-pyren-1-yl-9-octadecenamide can also be used as a starting material or intermediate in the synthesis of more complex molecules for various applications, including pharmaceuticals, agrochemicals, and other specialty chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 70283-04-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,0,2,8 and 3 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 70283-04:
(7*7)+(6*0)+(5*2)+(4*8)+(3*3)+(2*0)+(1*4)=104
104 % 10 = 4
So 70283-04-4 is a valid CAS Registry Number.
InChI:InChI=1/C34H43NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20-32(36)35-31-26-24-29-22-21-27-18-17-19-28-23-25-30(31)34(29)33(27)28/h9-10,17-19,21-26H,2-8,11-16,20H2,1H3,(H,35,36)/b10-9+