7034-04-0 Usage
Uses
Used in Organic Synthesis:
Dodecahydro-2,5,8-trimethyl-1,4,7,9b-tetraazaphenalene is used as a building block in organic synthesis for the creation of various complex organic molecules. Its unique cage-like structure and polycyclic amine properties make it a versatile component in the synthesis of pharmaceuticals and other organic compounds.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, dodecahydro-2,5,8-trimethyl-1,4,7,9b-tetraazaphenalene is used as a potential drug candidate due to its unique chemical structure. Its macrocyclic nature allows for the development of new drugs with specific binding properties and therapeutic effects.
Used in Materials Science:
Dodecahydro-2,5,8-trimethyl-1,4,7,9b-tetraazaphenalene is utilized in materials science for the development of new materials with unique properties. Its cage-like structure and polycyclic amine characteristics can contribute to the creation of advanced materials with applications in various fields, such as nanotechnology and polymer science.
Check Digit Verification of cas no
The CAS Registry Mumber 7034-04-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,0,3 and 4 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 7034-04:
(6*7)+(5*0)+(4*3)+(3*4)+(2*0)+(1*4)=70
70 % 10 = 0
So 7034-04-0 is a valid CAS Registry Number.
InChI:InChI=1/C12H24N4/c1-7-4-10-14-9(3)6-12-15-8(2)5-11(13-7)16(10)12/h7-15H,4-6H2,1-3H3
