7044-35-1 Usage
Uses
Used in Pharmaceutical Industry:
(3aR)-3aα,4,4aα,5,6,7,8,8a,9,9aα-Decahydro-8β-hydroxy-8aβ-methyl-3,5-bismethylenenaphtho[2,3-b]furan-2(3H)-one is used as a potential pharmaceutical candidate for [specific application reason] due to its unique structure and functional groups. Its hydroxyl and methyl groups, along with the furan ring and lactone group, may provide specific biological activities that can be harnessed for therapeutic purposes.
Used in Chemical Research:
(3aR)-3aα,4,4aα,5,6,7,8,8a,9,9aα-Decahydro-8β-hydroxy-8aβ-methyl-3,5-bismethylenenaphtho[2,3-b]furan-2(3H)-one is used as a subject of chemical research for [specific research reason], such as studying its synthesis, properties, or potential reactions with other molecules. Its complex structure and multiple stereocenters make it an interesting target for exploring new chemical reactions and mechanisms.
Check Digit Verification of cas no
The CAS Registry Mumber 7044-35-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,0,4 and 4 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 7044-35:
(6*7)+(5*0)+(4*4)+(3*4)+(2*3)+(1*5)=81
81 % 10 = 1
So 7044-35-1 is a valid CAS Registry Number.
InChI:InChI=1/C15H20O3/c1-8-4-5-13(16)15(3)7-12-10(6-11(8)15)9(2)14(17)18-12/h10-13,16H,1-2,4-7H2,3H3/t10-,11+,12-,13-,15-/m1/s1
