7047-54-3 Usage
Uses
Used in Pharmaceutical Industry:
[16R,(-)]-Kaurane-6β,16α,17-triol is used as a therapeutic agent for various diseases due to its ability to modulate several cellular pathways. Its anti-inflammatory, anti-cancer, and anti-microbial properties make it a promising candidate for the development of new drugs and pharmaceuticals.
Used in Drug Development:
[16R,(-)]-Kaurane-6β,16α,17-triol is used as a lead compound for the development of new drugs and pharmaceuticals. Its diverse biological activities and potential to modulate cellular pathways make it a valuable asset in the search for novel therapeutic agents.
Used in Research:
[16R,(-)]-Kaurane-6β,16α,17-triol is used as a research tool to study its various biological activities and potential applications in the treatment of various diseases. Its isolation from plant sources and the study of its structure-activity relationships can provide valuable insights into the development of new therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 7047-54-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,0,4 and 7 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 7047-54:
(6*7)+(5*0)+(4*4)+(3*7)+(2*5)+(1*4)=93
93 % 10 = 3
So 7047-54-3 is a valid CAS Registry Number.
InChI:InChI=1/C14H14O5/c1-3-17-10-6-5-9-7-11(13(15)18-4-2)14(16)19-12(9)8-10/h5-8H,3-4H2,1-2H3
