70474-33-8 Usage
Uses
Used in Pharmaceutical Industry:
(Z)-2-Methyl-2-butenoic acid [(1S,2R,7aS)-hexahydro-1-hydroxymethyl-1H-pyrrolizin-2-yl] ester is used as a pharmaceutical compound for its potential therapeutic applications. (Z)-2-Methyl-2-butenoic acid [(1S,2R,7aS)-hexahydro-1-hydroxymethyl-1H-pyrrolizin-2-yl] ester's unique structure and properties make it a promising candidate for the development of new drugs and treatments.
Used in Chemical Research:
In the field of chemical research, (Z)-2-Methyl-2-butenoic acid [(1S,2R,7aS)-hexahydro-1-hydroxymethyl-1H-pyrrolizin-2-yl] ester serves as a valuable compound for studying the properties and reactions of complex organic molecules. Its unique structure allows researchers to explore new synthetic pathways and develop innovative applications in various chemical processes.
Used in Natural Product Extraction:
(Z)-2-Methyl-2-butenoic acid [(1S,2R,7aS)-hexahydro-1-hydroxymethyl-1H-pyrrolizin-2-yl] ester is used in the extraction and isolation of natural products from plant sources, such as the stalks of Petasites japonicus Maxim. Its presence in these plants makes it an important target for the development of extraction methods and techniques to obtain this valuable compound for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 70474-33-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,0,4,7 and 4 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 70474-33:
(7*7)+(6*0)+(5*4)+(4*7)+(3*4)+(2*3)+(1*3)=118
118 % 10 = 8
So 70474-33-8 is a valid CAS Registry Number.
InChI:InChI=1/C13H21NO3/c1-3-9(2)13(16)17-12-7-14-6-4-5-11(14)10(12)8-15/h3,10-12,15H,4-8H2,1-2H3/b9-3-/t10-,11+,12+/m1/s1
