704879-73-2 Usage
Uses
Used in Pharmaceutical Industry:
2H-1,4-Benzoxazin-8-ol, 3,4-dihydro(9CI) is used as a pharmaceutical compound for its potential therapeutic applications. Its antifungal and antibacterial properties make it a promising candidate for the development of new drugs to combat infections. Additionally, its antioxidant and anti-inflammatory effects contribute to its potential use in treating various diseases and conditions.
Used in Antimicrobial Applications:
In the field of antimicrobial research, 2H-1,4-Benzoxazin-8-ol, 3,4-dihydro(9CI) is used as an antimicrobial agent for its ability to inhibit the growth of fungi and bacteria. This property can be utilized in the development of new antimicrobial drugs and treatments, particularly for resistant strains.
Used in Antioxidant and Anti-inflammatory Applications:
2H-1,4-Benzoxazin-8-ol, 3,4-dihydro(9CI) is used as an antioxidant and anti-inflammatory agent due to its ability to neutralize free radicals and reduce inflammation. This makes it a potential candidate for the development of treatments for various inflammatory and oxidative stress-related conditions.
Used in Plant Defense Mechanisms Research:
In the field of plant biology, 2H-1,4-Benzoxazin-8-ol, 3,4-dihydro(9CI) is used as a subject of research for its potential role in plant defense mechanisms. Understanding its function in plants can provide insights into natural defense strategies and potentially lead to the development of new crop protection methods.
Check Digit Verification of cas no
The CAS Registry Mumber 704879-73-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,0,4,8,7 and 9 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 704879-73:
(8*7)+(7*0)+(6*4)+(5*8)+(4*7)+(3*9)+(2*7)+(1*3)=192
192 % 10 = 2
So 704879-73-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H9NO2/c10-7-3-1-2-6-8(7)11-5-4-9-6/h1-3,9-10H,4-5H2
