704884-76-4 Usage
Uses
Used in Advanced Organic Synthesis:
4,5-Difluoro-2-methylphenol is used as a key intermediate in the synthesis of complex organic molecules. Its unique structure and reactivity allow for the creation of a wide range of compounds with diverse applications in various industries.
Used in Pharmaceutical Research:
4,5-Difluoro-2-methylphenol is employed as a building block in the development of new pharmaceutical compounds. Its specific properties enable the design of drugs with targeted effects, potentially leading to more effective treatments for various medical conditions.
Used in Chemical Databases:
The detailed properties of 4,5-Difluoro-2-methylphenol, such as its molecular weight, boiling point, and melting point, are provided by chemical databases. These properties are essential for precise scientific use and understanding the compound's behavior in different conditions.
Used in Safety and Handling Protocols:
Due to its potential hazards, 4,5-Difluoro-2-methylphenol requires proper handling and storage procedures. It is crucial to follow safety guidelines to minimize risks associated with its use in research and industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 704884-76-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,0,4,8,8 and 4 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 704884-76:
(8*7)+(7*0)+(6*4)+(5*8)+(4*8)+(3*4)+(2*7)+(1*6)=184
184 % 10 = 4
So 704884-76-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H6F2O/c1-4-2-5(8)6(9)3-7(4)10/h2-3,10H,1H3
704884-76-4Relevant academic research and scientific papers
Fluorine containing benzaldehydes
-
Page 8, (2008/06/13)
Benzaldehyde derivatives (I), phenol derivatives (II) (with the exception of 4-fluoro-2-methylphenol) and benzylamine derivatives (V) (with the exception of 5-fluoro-2-hydroxy-N,N-dimethylbenzylamine) are new. Benzaldehyde derivatives of formula (I), phen