70523-22-7 Usage
Uses
Used in Pharmaceutical Industry:
URACIL-5-BORONIC ACID is used as an active pharmaceutical intermediate for the development of drugs targeting various diseases. Its ability to form covalent bonds with specific biomolecules makes it a promising candidate for the design of targeted therapies.
Used in Analytical Chemistry:
In the field of analytical chemistry, URACIL-5-BORONIC ACID is used for probing the interactions between boronic acids and cis-diol-containing biomolecules. This is achieved through affinity capillary electrophoresis, a technique that allows for the separation and analysis of biomolecules based on their interactions with specific ligands.
Used in Drug Design and Development:
URACIL-5-BORONIC ACID is employed as a key component in the design and development of new drugs. Its unique structure and reactivity enable the creation of molecules with specific binding properties, which can be exploited to target disease-causing proteins or enzymes.
Used in Biochemical Research:
In biochemical research, URACIL-5-BORONIC ACID serves as a valuable tool for studying the interactions between biomolecules and their ligands. Its ability to form covalent bonds with cis-diol-containing biomolecules allows researchers to investigate the binding mechanisms and kinetics of these interactions, providing insights into the molecular basis of various biological processes.
Overall, URACIL-5-BORONIC ACID is a versatile compound with a wide range of applications in the pharmaceutical, chemical, and biochemical fields. Its unique properties make it an essential tool for drug development, analytical chemistry, and biochemical research.
Check Digit Verification of cas no
The CAS Registry Mumber 70523-22-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,0,5,2 and 3 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 70523-22:
(7*7)+(6*0)+(5*5)+(4*2)+(3*3)+(2*2)+(1*2)=97
97 % 10 = 7
So 70523-22-7 is a valid CAS Registry Number.
InChI:InChI=1/C4H5BN2O4/c8-3-2(5(10)11)1-6-4(9)7-3/h1,10-11H,(H2,6,7,8,9)
