70541-99-0 Usage
Uses
Used in Pharmaceutical Synthesis:
5-Cyano-4-methyl-3-phenyl-2-thiophenecarboxamide is used as an intermediate in the synthesis of various pharmaceuticals for its unique molecular structure and properties. It contributes to the development of novel drugs with potential therapeutic applications.
Used in Organic Compounds Synthesis:
In the field of organic chemistry, 5-Cyano-4-methyl-3-phenyl-2-thiophenecarboxamide serves as a key component in the synthesis of organic compounds. Its distinctive structure allows for the creation of new organic materials with specific properties and potential applications in various industries.
Used in Chemical Research:
5-Cyano-4-methyl-3-phenyl-2-thiophenecarboxamide is utilized in chemical research to explore its properties and potential reactions with other compounds. This research aids in understanding its behavior and reactivity, which can lead to the discovery of new chemical processes and applications.
Used in Drug Development:
In the pharmaceutical industry, 5-Cyano-4-methyl-3-phenyl-2-thiophenecarboxamide is used as a building block in drug development. Its unique structure and properties make it a promising candidate for the creation of new drugs with improved efficacy and selectivity.
Used in Material Science:
5-Cyano-4-methyl-3-phenyl-2-thiophenecarboxamide is employed in material science for the development of new organic materials. Its molecular structure allows for the design of materials with specific properties, such as conductivity, stability, or reactivity, which can be applied in various technological applications.
Check Digit Verification of cas no
The CAS Registry Mumber 70541-99-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,0,5,4 and 1 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 70541-99:
(7*7)+(6*0)+(5*5)+(4*4)+(3*1)+(2*9)+(1*9)=120
120 % 10 = 0
So 70541-99-0 is a valid CAS Registry Number.
InChI:InChI=1/C13H10N2OS/c1-8-10(7-14)17-12(13(15)16)11(8)9-5-3-2-4-6-9/h2-6H,1H3,(H2,15,16)
