70565-23-0 Usage
Explanation
The molecular formula represents the number of atoms of each element present in a molecule of the compound.
Explanation
Isoxazole is a five-membered heterocyclic ring containing two oxygen atoms and one nitrogen atom. The compound belongs to this class of compounds.
Explanation
These are the key structural components of the compound, which contribute to its chemical properties and potential applications.
Explanation
The compound can be used as a precursor or intermediate in the synthesis of more complex organic molecules, including pharmaceuticals.
Explanation
The compound has been investigated for its possible biological effects, which could lead to the development of new drugs or therapies.
Explanation
Due to its unique structure and properties, the compound has a wide range of potential applications, making it an important chemical compound in different areas of research and industry.
Class
Isoxazole compounds
Structural features
2,6-dichlorophenyl group
Methyl group
Isoxazol-4-yl group
Ethan-1-one backbone
Potential uses
Building block in organic synthesis
Starting material in pharmaceutical production
Biological activities
Studied for potential applications in medicinal chemistry
Versatility
Diverse applications in various fields
Check Digit Verification of cas no
The CAS Registry Mumber 70565-23-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,0,5,6 and 5 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 70565-23:
(7*7)+(6*0)+(5*5)+(4*6)+(3*5)+(2*2)+(1*3)=120
120 % 10 = 0
So 70565-23-0 is a valid CAS Registry Number.
InChI:InChI=1/C12H9Cl2NO2/c1-6(16)10-7(2)17-15-12(10)11-8(13)4-3-5-9(11)14/h3-5H,1-2H3
