705944-29-2 Usage
Uses
Used in Organic Synthesis:
1-(4-ALLYL-PIPERAZIN-1-YL)-2-AMINO-ETHANONE 2 HCL is used as a building block in organic synthesis for its unique structural features, including the allyl group that can participate in various chemical reactions, facilitating the creation of new compounds with potential applications.
Used in Pharmaceutical Development:
In the pharmaceutical industry, 1-(4-ALLYL-PIPERAZIN-1-YL)-2-AMINO-ETHANONE 2 HCL is used as a precursor or intermediate in the synthesis of drugs. Its structural components may contribute to the development of new medications, particularly those targeting specific biological pathways or receptors.
Used in Chemical Research:
1-(4-ALLYL-PIPERAZIN-1-YL)-2-AMINO-ETHANONE 2 HCL serves as a subject of study in chemical research, where its properties and reactivity are explored to understand its potential in creating new chemical entities or improving existing synthetic methods.
Check Digit Verification of cas no
The CAS Registry Mumber 705944-29-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,0,5,9,4 and 4 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 705944-29:
(8*7)+(7*0)+(6*5)+(5*9)+(4*4)+(3*4)+(2*2)+(1*9)=172
172 % 10 = 2
So 705944-29-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H17N3O.2ClH/c1-2-3-11-4-6-12(7-5-11)9(13)8-10;;/h2H,1,3-8,10H2;2*1H
