7064-37-1 Usage
Uses
Used in Organic Synthesis:
Isoxazole, 4-bromo-5-methyl(6CI,7CI,8CI,9CI) is utilized as a key intermediate in various organic synthesis reactions. Its unique structure allows for the formation of diverse chemical entities, making it a valuable component in the synthesis of complex organic molecules.
Used in Pharmaceutical Synthesis:
In the pharmaceutical industry, Isoxazole, 4-bromo-5-methyl(6CI,7CI,8CI,9CI) is employed as a building block for the synthesis of novel drug candidates. Its presence in the molecular structure can impart specific biological activities, contributing to the development of new therapeutic agents.
Used in Agrochemical Development:
Isoxazole, 4-bromo-5-methyl(6CI,7CI,8CI,9CI) also finds application in the agrochemical sector, where it is used in the synthesis of new pesticides and other crop protection agents. Its unique chemical properties can enhance the effectiveness of these products, leading to improved agricultural outcomes.
Used in Medicinal Chemistry Research:
Isoxazole, 4-bromo-5-methyl(6CI,7CI,8CI,9CI) is also utilized in medicinal chemistry research, where it serves as a starting point for the design and synthesis of bioactive molecules. Its structural features can be manipulated to explore new avenues in drug discovery and development.
Used in Bioactive Molecule Development:
Isoxazole, 4-bromo-5-methyl(6CI,7CI,8CI,9CI) is employed in the development of bioactive molecules, which have potential applications in various fields, including therapeutics, diagnostics, and biomaterials. Its unique properties make it a promising candidate for the creation of molecules with specific biological functions.
Check Digit Verification of cas no
The CAS Registry Mumber 7064-37-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,0,6 and 4 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 7064-37:
(6*7)+(5*0)+(4*6)+(3*4)+(2*3)+(1*7)=91
91 % 10 = 1
So 7064-37-1 is a valid CAS Registry Number.
InChI:InChI=1/C4H4BrNO/c1-3-4(5)2-6-7-3/h2H,1H3
