70757-44-7 Usage
Uses
Used in Pesticide Industry:
6-BROMO-2,4,5-TRICHLOROPHENOL is used as a pesticide for its ability to control and eliminate pests. Its antimicrobial properties help protect crops from damage caused by insects and other organisms.
Used in Fungicide Industry:
6-BROMO-2,4,5-TRICHLOROPHENOL is used as a fungicide to prevent the growth of fungi and protect plants from fungal diseases. This helps maintain crop health and yield.
Used in Bactericide Applications:
6-BROMO-2,4,5-TRICHLOROPHENOL is used as a bactericide to kill or inhibit the growth of bacteria. This can be useful in various settings, including agriculture and healthcare, to prevent the spread of bacterial infections.
Used in Pharmaceutical Manufacturing:
6-BROMO-2,4,5-TRICHLOROPHENOL is used as an intermediate in the synthesis of various pharmaceuticals. Its unique chemical structure contributes to the development of new drugs with potential therapeutic benefits.
Used in Dye Production:
6-BROMO-2,4,5-TRICHLOROPHENOL is used in the production of dyes due to its chemical properties. It can be a component in the creation of dyes for textiles, paints, and other applications.
Used in Chemical Compound Synthesis:
6-BROMO-2,4,5-TRICHLOROPHENOL is used as a building block in the synthesis of other chemical compounds. Its versatility allows it to be a component in various chemical reactions, leading to the development of new products.
Check Digit Verification of cas no
The CAS Registry Mumber 70757-44-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,0,7,5 and 7 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 70757-44:
(7*7)+(6*0)+(5*7)+(4*5)+(3*7)+(2*4)+(1*4)=137
137 % 10 = 7
So 70757-44-7 is a valid CAS Registry Number.
InChI:InChI=1/C6H2BrCl3O/c7-4-5(10)2(8)1-3(9)6(4)11/h1,11H
