70802-12-9 Usage
Uses
Used in Pharmaceutical Industry:
α-D-Glucopyranose 6-(3-pyridinecarboxylate) is used as a pharmaceutical compound for its potential therapeutic applications. α-D-Glucopyranose 6-(3-pyridinecarboxylate)'s unique structure may allow it to interact with specific biological targets, making it a candidate for the development of new drugs or drug delivery systems.
Used in Chemical Research:
In the field of chemical research, α-D-Glucopyranose 6-(3-pyridinecarboxylate) can be used as a starting material for the synthesis of various complex organic molecules. Its unique structure may provide new insights into the reactivity and properties of pyridine glycosides, leading to the discovery of novel chemical reactions and applications.
Used in Material Science:
α-D-Glucopyranose 6-(3-pyridinecarboxylate)'s unique structure and properties may also make it a candidate for use in the development of new materials, such as polymers or coatings with specific properties. Researchers in material science may explore the potential of α-D-Glucopyranose 6-(3-pyridinecarboxylate) to create materials with enhanced properties, such as improved stability, biocompatibility, or responsiveness to environmental stimuli.
Used in Analytical Chemistry:
α-D-Glucopyranose 6-(3-pyridinecarboxylate) can be used as a reference compound or standard in analytical chemistry for the development and validation of new methods for the analysis of pyridine glycosides. Its well-defined structure and properties make it an ideal candidate for use in the calibration of analytical instruments and the establishment of reference methods for the quantification and characterization of similar compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 70802-12-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,0,8,0 and 2 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 70802-12:
(7*7)+(6*0)+(5*8)+(4*0)+(3*2)+(2*1)+(1*2)=99
99 % 10 = 9
So 70802-12-9 is a valid CAS Registry Number.
InChI:InChI=1/C12H15NO7/c14-8-7(20-12(18)10(16)9(8)15)5-19-11(17)6-2-1-3-13-4-6/h1-4,7-10,12,14-16,18H,5H2/t7-,8-,9+,10-,12+/m1/s1
