70833-37-3 Usage
General Description
Bis(3-amino-4,5,6,7-tetrachloro-1H-isoindol-1-one oximato-N2,O1)nickel is a complex chemical compound that contains a nickel atom bonded to two molecules of 3-amino-4,5,6,7-tetrachloro-1H-isoindol-1-one oxime. bis(3-amino-4,5,6,7-tetrachloro-1H-isoindol-1-one oximato-N2,O1)nickel is commonly used in coordination chemistry and as a catalyst in various organic reactions. It has potential applications in the field of industrial chemistry, particularly in the production of polymers and other organic compounds. The presence of the tetrachloro-1H-isoindol-1-one oxime ligands contributes to the stability and reactivity of the nickel complex, making it a valuable tool in synthetic and analytical chemistry. Overall, bis(3-amino-4,5,6,7-tetrachloro-1H-isoindol-1-one oximato-N2,O1)nickel is an important and versatile chemical compound with potential applications in various areas of chemistry and industry.
Check Digit Verification of cas no
The CAS Registry Mumber 70833-37-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,0,8,3 and 3 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 70833-37:
(7*7)+(6*0)+(5*8)+(4*3)+(3*3)+(2*3)+(1*7)=123
123 % 10 = 3
So 70833-37-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H3Cl4N3O/c9-3-1-2(4(10)6(12)5(3)11)8(15-16)14-7(1)13/h16H,(H2,13,14,15)