70851-49-9 Usage
Uses
Used in Biochemistry:
1,1-Dimethylsila-14-crown-5 is used as a research tool in biochemistry for studying the interactions between molecules and understanding the underlying mechanisms of various biological processes.
Used in Organometallic Chemistry:
In organometallic chemistry, 1,1-Dimethylsila-14-crown-5 is used as a ligand or a catalyst to facilitate specific chemical reactions, enhancing the efficiency and selectivity of the processes.
Used in Pharmaceutical Chemistry:
1,1-Dimethylsila-14-crown-5 is employed in pharmaceutical chemistry for the development of new drugs and drug delivery systems. Its unique properties allow it to be used in the synthesis of pharmaceutical compounds and as a component in drug formulations to improve their efficacy and safety.
Used in Chemical Research and Experimentation:
1,1-Dimethylsila-14-crown-5 is used as a reagent or a reference compound in various chemical research and experimentation applications. Its versatile nature makes it suitable for a wide range of studies, from fundamental research to applied science.
Check Digit Verification of cas no
The CAS Registry Mumber 70851-49-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,0,8,5 and 1 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 70851-49:
(7*7)+(6*0)+(5*8)+(4*5)+(3*1)+(2*4)+(1*9)=129
129 % 10 = 9
So 70851-49-9 is a valid CAS Registry Number.
InChI:InChI=1/C10H22O5Si/c1-16(2)14-9-7-12-5-3-11-4-6-13-8-10-15-16/h3-10H2,1-2H3
