70857-50-0 Usage
Chemical class
Quinazolinone derivatives
Core structure
Quinazolinone
Substituents
6-chloro, cyclopropyl, phenyl
Biological activities
Antibacterial, antifungal
Potential therapeutic effects
Neurological disorders, cancer
Molecular structure and properties
Specific molecular structure and properties make it a promising candidate for further research and development in medicinal chemistry and drug discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 70857-50-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,0,8,5 and 7 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 70857-50:
(7*7)+(6*0)+(5*8)+(4*5)+(3*7)+(2*5)+(1*0)=140
140 % 10 = 0
So 70857-50-0 is a valid CAS Registry Number.
InChI:InChI=1/C17H13ClN2O/c18-12-6-9-15-14(10-12)16(11-4-2-1-3-5-11)19-17(21)20(15)13-7-8-13/h1-6,9-10,13H,7-8H2
