70867-60-6 Usage
Uses
Used in Pharmaceutical Industry:
2,5-DIMETHYL-6-METHOXYBENZOSELENAZOLE is used as a pharmaceutical intermediate for the synthesis of various therapeutic agents. Its organoselenium nature allows it to be a key component in the development of drugs targeting specific diseases, such as cancer, neurodegenerative disorders, and infectious diseases.
Used in Antioxidant Applications:
2,5-DIMETHYL-6-METHOXYBENZOSELENAZOLE is used as an antioxidant in various applications, including cosmetics, food additives, and pharmaceuticals. The selenium atom in the compound contributes to its antioxidant properties, helping to neutralize free radicals and protect cells from oxidative damage.
Used in Chemical Synthesis:
2,5-DIMETHYL-6-METHOXYBENZOSELENAZOLE is used as a building block in the synthesis of more complex organic compounds. Its unique structure and reactivity make it a valuable precursor for the development of new molecules with potential applications in various industries.
Used in Research and Development:
2,5-DIMETHYL-6-METHOXYBENZOSELENAZOLE is used as a research compound in academic and industrial laboratories. Its unique properties and potential applications make it an interesting subject for studies aimed at understanding its chemical behavior, biological activity, and potential uses in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 70867-60-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,0,8,6 and 7 respectively; the second part has 2 digits, 6 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 70867-60:
(7*7)+(6*0)+(5*8)+(4*6)+(3*7)+(2*6)+(1*0)=146
146 % 10 = 6
So 70867-60-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H11NOSe/c1-6-4-8-10(5-9(6)12-3)13-7(2)11-8/h4-5H,1-3H3
